C22H37N3O7 — CID 71202514
ethyl 6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxy-2-(1-methylimidazol-4-yl)hexanoate (PubChem CID 71202514) has the molecular formula C22H37N3O7 and a molecular weight of 455.55 g/mol. Its IUPAC name is ethyl 6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxy-2-(1-methylimidazol-4-yl)hexanoate.
| Compound Name | ethyl 6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxy-2-(1-methylimidazol-4-yl)hexanoate |
|---|---|
| PubChem CID | 71202514 |
| Molecular Formula | C22H37N3O7 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | ethyl 6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxy-2-(1-methylimidazol-4-yl)hexanoate |
| SMILES | CCOC(=O)C(c1cn(C)cn1)C(O)CCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37N3O7/c1-9-30-18(27)17(15-13-24(8)14-23-15)16(26)11-10-12-25(19(28)31-21(2,3)4)20(29)32-22(5,6)7/h13-14,16-17,26H,9-12H2,1-8H3 |
| InChIKey | VIFBLMQHCJQKJT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|