C23H35NO6 — CID 134969933
ethyl (2R,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylbutanoate (PubChem CID 134969933) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is ethyl (2R,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylbutanoate.
| Compound Name | ethyl (2R,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylbutanoate |
|---|---|
| PubChem CID | 134969933 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | ethyl (2R,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylbutanoate |
| SMILES | CCOC(=O)[C@@](C)([C@H](C)c1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H35NO6/c1-10-28-18(25)23(9,16(2)17-14-12-11-13-15-17)24(19(26)29-21(3,4)5)20(27)30-22(6,7)8/h11-16H,10H2,1-9H3/t16-,23-/m1/s1 |
| InChIKey | MWIFZEHCYNFRBJ-WAIKUNEKSA-N |
| XLogP | 5.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|