C23H27NO4 — CID 87661307
tert-butyl N,N-bis(3-oxo-1-phenylpropyl)carbamate (PubChem CID 87661307) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is tert-butyl N,N-bis(3-oxo-1-phenylpropyl)carbamate.
| Compound Name | tert-butyl N,N-bis(3-oxo-1-phenylpropyl)carbamate |
|---|---|
| PubChem CID | 87661307 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl N,N-bis(3-oxo-1-phenylpropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(CC=O)c1ccccc1)C(CC=O)c1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-23(2,3)28-22(27)24(20(14-16-25)18-10-6-4-7-11-18)21(15-17-26)19-12-8-5-9-13-19/h4-13,16-17,20-21H,14-15H2,1-3H3 |
| InChIKey | ZOQXRMGAQVFVBR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|