C27H49NO3Sn — CID 177443507
tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]-N-(1-tributylstannylethyl)carbamate (PubChem CID 177443507) has the molecular formula C27H49NO3Sn and a molecular weight of 554.40 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]-N-(1-tributylstannylethyl)carbamate.
| Compound Name | tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]-N-(1-tributylstannylethyl)carbamate |
|---|---|
| PubChem CID | 177443507 |
| Molecular Formula | C27H49NO3Sn |
| Molecular Weight | 554.40 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]-N-(1-tributylstannylethyl)carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(C)N(C(=O)OC(C)(C)C)[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C15H22NO3.3C4H9.Sn/c1-5-16(14(18)19-15(2,3)4)13(11-17)12-9-7-6-8-10-12;3*1-3-4-2;/h5-10,13,17H,11H2,1-4H3;3*1,3-4H2,2H3;/t13-;;;;/m1..../s1 |
| InChIKey | XNCVUYDOQULTOF-SVZPRBGCSA-N |
| XLogP | 7.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.40 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |