C24H44OSn — CID 134889352
(3R,4R)-2,3-dimethyl-4-phenyl-4-tributylstannylbutan-2-ol (PubChem CID 134889352) has the molecular formula C24H44OSn and a molecular weight of 467.33 g/mol. Its IUPAC name is (3R,4R)-2,3-dimethyl-4-phenyl-4-tributylstannylbutan-2-ol.
| Compound Name | (3R,4R)-2,3-dimethyl-4-phenyl-4-tributylstannylbutan-2-ol |
|---|---|
| PubChem CID | 134889352 |
| Molecular Formula | C24H44OSn |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (3R,4R)-2,3-dimethyl-4-phenyl-4-tributylstannylbutan-2-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H](c1ccccc1)[C@H](C)C(C)(C)O |
| InChI | InChI=1S/C12H17O.3C4H9.Sn/c1-10(12(2,3)13)9-11-7-5-4-6-8-11;3*1-3-4-2;/h4-10,13H,1-3H3;3*1,3-4H2,2H3;/t10-;;;;/m0..../s1 |
| InChIKey | AKAVNVWELGMPGF-CZEDPBFNSA-N |
| XLogP | 7.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |