C40H70OSn2 — CID 10509574
(1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol (PubChem CID 10509574) has the molecular formula C40H70OSn2 and a molecular weight of 804.42 g/mol. Its IUPAC name is (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol.
| Compound Name | (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol |
|---|---|
| PubChem CID | 10509574 |
| Molecular Formula | C40H70OSn2 |
| Molecular Weight | 804.42 g/mol |
| Exact Mass | 806.35 |
| IUPAC Name | (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C([C@@H](Cc1ccccc1)[C@H](O)c1ccccc1)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H16O.6C4H9.2Sn/c1-13(12-14-8-4-2-5-9-14)16(17)15-10-6-3-7-11-15;6*1-3-4-2;;/h1-11,13,16-17H,12H2;6*1,3-4H2,2H3;;/t13-,16-;;;;;;;;/m0......../s1 |
| InChIKey | ZMTJNTJJZVRSOX-SSUKNVAISA-N |
| XLogP | 13.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.42 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |