About (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol
(1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol (PubChem CID 10509574) has the molecular formula C40H70OSn2
and a molecular weight of 804.42 g/mol. Its IUPAC name is (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol.
Molecular Properties
| Compound Name | (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol |
| PubChem CID | 10509574 |
| Molecular Formula | C40H70OSn2 |
| Molecular Weight | 804.42 g/mol |
| Exact Mass | 806.35 |
| IUPAC Name | (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C([C@@H](Cc1ccccc1)[C@H](O)c1ccccc1)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H16O.6C4H9.2Sn/c1-13(12-14-8-4-2-5-9-14)16(17)15-10-6-3-7-11-15;6*1-3-4-2;;/h1-11,13,16-17H,12H2;6*1,3-4H2,2H3;;/t13-,16-;;;;;;;;/m0......../s1 |
| InChIKey | ZMTJNTJJZVRSOX-SSUKNVAISA-N |
| XLogP | 13.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 804.42 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol?
The IUPAC name of (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol (CID 10509574) is (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol.
What is the SMILES notation for (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol?
The canonical SMILES for (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol is CCCC[Sn](CCCC)(CCCC)C([C@@H](Cc1ccccc1)[C@H](O)c1ccccc1)[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol?
The InChIKey is ZMTJNTJJZVRSOX-SSUKNVAISA-N. The full InChI is InChI=1S/C16H16O.6C4H9.2Sn/c1-13(12-14-8-4-2-5-9-14)16(17)15-10-6-3-7-11-15;6*1-3-4-2;;/h1-11,13,16-17H,12H2;6*1,3-4H2,2H3;;/t13-,16-;;;;;;;;/m0......../s1.
What are the key properties of (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol?
(1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol has a molecular weight of 804.42 g/mol, XLogP of 13.19, 25 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-benzyl-1-phenyl-3,3-bis(tributylstannyl)propan-1-ol is sourced from PubChem (CID 10509574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).