About methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol
methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol (PubChem CID 167593098) has the molecular formula C25H44O
and a molecular weight of 360.63 g/mol. Its IUPAC name is methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol.
Molecular Properties
| Compound Name | methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol |
| PubChem CID | 167593098 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol |
| SMILES | C.C.C.CC[C@@H](C)Cc1ccccc1.CC[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H16O.C11H16.3CH4/c1-3-9(2)11(12)10-7-5-4-6-8-10;1-3-10(2)9-11-7-5-4-6-8-11;;;/h4-9,11-12H,3H2,1-2H3;4-8,10H,3,9H2,1-2H3;3*1H4/t9-,11+;10-;;;/m11.../s1 |
| InChIKey | IRHBKRYKAXZORU-HTBCKBIXSA-N |
| XLogP | 7.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol?
The IUPAC name of methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol (CID 167593098) is methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol.
What is the SMILES notation for methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol?
The canonical SMILES for methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol is C.C.C.CC[C@@H](C)Cc1ccccc1.CC[C@@H](C)[C@H](O)c1ccccc1.
What is the InChIKey of methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol?
The InChIKey is IRHBKRYKAXZORU-HTBCKBIXSA-N. The full InChI is InChI=1S/C11H16O.C11H16.3CH4/c1-3-9(2)11(12)10-7-5-4-6-8-10;1-3-10(2)9-11-7-5-4-6-8-11;;;/h4-9,11-12H,3H2,1-2H3;4-8,10H,3,9H2,1-2H3;3*1H4/t9-,11+;10-;;;/m11.../s1.
What are the key properties of methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol?
methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol has a molecular weight of 360.63 g/mol, XLogP of 7.95, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[(2R)-2-methylbutyl]benzene;(1S,2R)-2-methyl-1-phenylbutan-1-ol is sourced from PubChem (CID 167593098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).