C27H34NOP — CID 138732435
(1R,2S)-2-[[[4-[(2S)-2-methylbutyl]phenyl]-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol (PubChem CID 138732435) has the molecular formula C27H34NOP and a molecular weight of 419.55 g/mol. Its IUPAC name is (1R,2S)-2-[[[4-[(2S)-2-methylbutyl]phenyl]-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[[[4-[(2S)-2-methylbutyl]phenyl]-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 138732435 |
| Molecular Formula | C27H34NOP |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (1R,2S)-2-[[[4-[(2S)-2-methylbutyl]phenyl]-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol |
| SMILES | CC[C@H](C)Cc1ccc(P(CN[C@@H](C)[C@H](O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H34NOP/c1-4-21(2)19-23-15-17-26(18-16-23)30(25-13-9-6-10-14-25)20-28-22(3)27(29)24-11-7-5-8-12-24/h5-18,21-22,27-29H,4,19-20H2,1-3H3/t21-,22-,27-,30?/m0/s1 |
| InChIKey | FNRJMONOFVTGAN-AMDSOTTQSA-N |
| XLogP | 5.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|