C23H26NO2P — CID 138732462
(1R,2S)-2-[[(2-methoxyphenyl)-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol (PubChem CID 138732462) has the molecular formula C23H26NO2P and a molecular weight of 379.44 g/mol. Its IUPAC name is (1R,2S)-2-[[(2-methoxyphenyl)-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[[(2-methoxyphenyl)-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 138732462 |
| Molecular Formula | C23H26NO2P |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (1R,2S)-2-[[(2-methoxyphenyl)-phenylphosphanyl]methylamino]-1-phenylpropan-1-ol |
| SMILES | COc1ccccc1[P@@](CN[C@@H](C)[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26NO2P/c1-18(23(25)19-11-5-3-6-12-19)24-17-27(20-13-7-4-8-14-20)22-16-10-9-15-21(22)26-2/h3-16,18,23-25H,17H2,1-2H3/t18-,23-,27-/m0/s1 |
| InChIKey | PRKJLQYGGSYNMV-CAASOKRLSA-N |
| XLogP | 3.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|