C17H21NO2 — CID 54310024
(1R,2S)-2-[(2-methoxyphenyl)methylamino]-1-phenylpropan-1-ol (PubChem CID 54310024) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1R,2S)-2-[(2-methoxyphenyl)methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[(2-methoxyphenyl)methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 54310024 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1R,2S)-2-[(2-methoxyphenyl)methylamino]-1-phenylpropan-1-ol |
| SMILES | COc1ccccc1CN[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-13(17(19)14-8-4-3-5-9-14)18-12-15-10-6-7-11-16(15)20-2/h3-11,13,17-19H,12H2,1-2H3/t13-,17-/m0/s1 |
| InChIKey | SKFKVJBOGIQGCP-GUYCJALGSA-N |
| XLogP | 2.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |