C23H26NOP — CID 102405942
(1R)-N-[2-[(2-methoxyphenyl)-phenylphosphanyl]ethyl]-1-phenylethanamine (PubChem CID 102405942) has the molecular formula C23H26NOP and a molecular weight of 363.44 g/mol. Its IUPAC name is (1R)-N-[2-[(2-methoxyphenyl)-phenylphosphanyl]ethyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[2-[(2-methoxyphenyl)-phenylphosphanyl]ethyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 102405942 |
| Molecular Formula | C23H26NOP |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (1R)-N-[2-[(2-methoxyphenyl)-phenylphosphanyl]ethyl]-1-phenylethanamine |
| SMILES | COc1ccccc1P(CCN[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26NOP/c1-19(20-11-5-3-6-12-20)24-17-18-26(21-13-7-4-8-14-21)23-16-10-9-15-22(23)25-2/h3-16,19,24H,17-18H2,1-2H3/t19-,26?/m1/s1 |
| InChIKey | QUISTXHDNWKSGO-ICCFGIFFSA-N |
| XLogP | 4.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|