C23H32O3P2 — CID 20718100
2-(3,4-dimethoxy-2,5-dimethylphospholan-1-yl)ethyl-(2-methoxyphenyl)-phenylphosphane (PubChem CID 20718100) has the molecular formula C23H32O3P2 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-2,5-dimethylphospholan-1-yl)ethyl-(2-methoxyphenyl)-phenylphosphane.
| Compound Name | 2-(3,4-dimethoxy-2,5-dimethylphospholan-1-yl)ethyl-(2-methoxyphenyl)-phenylphosphane |
|---|---|
| PubChem CID | 20718100 |
| Molecular Formula | C23H32O3P2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-(3,4-dimethoxy-2,5-dimethylphospholan-1-yl)ethyl-(2-methoxyphenyl)-phenylphosphane |
| SMILES | COc1ccccc1P(CCP1C(C)C(OC)C(OC)C1C)c1ccccc1 |
| InChI | InChI=1S/C23H32O3P2/c1-17-22(25-4)23(26-5)18(2)27(17)15-16-28(19-11-7-6-8-12-19)21-14-10-9-13-20(21)24-3/h6-14,17-18,22-23H,15-16H2,1-5H3 |
| InChIKey | CIBPZSUXFRTYEC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|