C30H32O4P2 — CID 25059236
(2,5-dimethoxyphenyl)-[2-[(2,5-dimethoxyphenyl)-phenylphosphanyl]ethyl]-phenylphosphane (PubChem CID 25059236) has the molecular formula C30H32O4P2 and a molecular weight of 518.53 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-[2-[(2,5-dimethoxyphenyl)-phenylphosphanyl]ethyl]-phenylphosphane.
| Compound Name | (2,5-dimethoxyphenyl)-[2-[(2,5-dimethoxyphenyl)-phenylphosphanyl]ethyl]-phenylphosphane |
|---|---|
| PubChem CID | 25059236 |
| Molecular Formula | C30H32O4P2 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (2,5-dimethoxyphenyl)-[2-[(2,5-dimethoxyphenyl)-phenylphosphanyl]ethyl]-phenylphosphane |
| SMILES | COc1ccc(OC)c([P@](CC[P@@](c2ccccc2)c2cc(OC)ccc2OC)c2ccccc2)c1 |
| InChI | InChI=1S/C30H32O4P2/c1-31-23-15-17-27(33-3)29(21-23)35(25-11-7-5-8-12-25)19-20-36(26-13-9-6-10-14-26)30-22-24(32-2)16-18-28(30)34-4/h5-18,21-22H,19-20H2,1-4H3/t35-,36+ |
| InChIKey | RTUPSASRVQOJJL-TYHGNQNSSA-N |
| XLogP | 5.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|