C24H27O6P — CID 54206257
phenyl-bis(2,4,6-trimethoxyphenyl)phosphane (PubChem CID 54206257) has the molecular formula C24H27O6P and a molecular weight of 442.45 g/mol. Its IUPAC name is phenyl-bis(2,4,6-trimethoxyphenyl)phosphane.
| Compound Name | phenyl-bis(2,4,6-trimethoxyphenyl)phosphane |
|---|---|
| PubChem CID | 54206257 |
| Molecular Formula | C24H27O6P |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | phenyl-bis(2,4,6-trimethoxyphenyl)phosphane |
| SMILES | COc1cc(OC)c(P(c2ccccc2)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C24H27O6P/c1-25-16-12-19(27-3)23(20(13-16)28-4)31(18-10-8-7-9-11-18)24-21(29-5)14-17(26-2)15-22(24)30-6/h7-15H,1-6H3 |
| InChIKey | PSROXFWMYAAEEX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|