C21H21O4P — CID 12977583
2-[(2,6-dimethoxyphenyl)-phenylphosphanyl]-3-methoxyphenol (PubChem CID 12977583) has the molecular formula C21H21O4P and a molecular weight of 368.37 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)-phenylphosphanyl]-3-methoxyphenol.
| Compound Name | 2-[(2,6-dimethoxyphenyl)-phenylphosphanyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 12977583 |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)-phenylphosphanyl]-3-methoxyphenol |
| SMILES | COc1cccc(O)c1P(c1ccccc1)c1c(OC)cccc1OC |
| InChI | InChI=1S/C21H21O4P/c1-23-17-12-7-11-16(22)20(17)26(15-9-5-4-6-10-15)21-18(24-2)13-8-14-19(21)25-3/h4-14,22H,1-3H3 |
| InChIKey | BYPHFZYQJGVILC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|