C22H22BrO4P — CID 151973130
(2-bromophenyl)-bis(2,6-dimethoxyphenyl)phosphane (PubChem CID 151973130) has the molecular formula C22H22BrO4P and a molecular weight of 461.29 g/mol. Its IUPAC name is (2-bromophenyl)-bis(2,6-dimethoxyphenyl)phosphane.
| Compound Name | (2-bromophenyl)-bis(2,6-dimethoxyphenyl)phosphane |
|---|---|
| PubChem CID | 151973130 |
| Molecular Formula | C22H22BrO4P |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | (2-bromophenyl)-bis(2,6-dimethoxyphenyl)phosphane |
| SMILES | COc1cccc(OC)c1P(c1ccccc1Br)c1c(OC)cccc1OC |
| InChI | InChI=1S/C22H22BrO4P/c1-24-16-10-7-11-17(25-2)21(16)28(20-14-6-5-9-15(20)23)22-18(26-3)12-8-13-19(22)27-4/h5-14H,1-4H3 |
| InChIKey | UBCDJGGDIBFKPE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|