C7H6Br2O — CID 11958056
1,2-dibromo-3-methoxybenzene (PubChem CID 11958056) has the molecular formula C7H6Br2O and a molecular weight of 265.93 g/mol. Its IUPAC name is 1,2-dibromo-3-methoxybenzene.
| Compound Name | 1,2-dibromo-3-methoxybenzene |
|---|---|
| PubChem CID | 11958056 |
| Molecular Formula | C7H6Br2O |
| Molecular Weight | 265.93 g/mol |
| Exact Mass | 263.88 |
| IUPAC Name | 1,2-dibromo-3-methoxybenzene |
| SMILES | COc1cccc(Br)c1Br |
| InChI | InChI=1S/C7H6Br2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 |
| InChIKey | KMUOJHYDIKYRQO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.93 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |