C15H18O4 — CID 174871155
phenol;1,2,3-trimethoxybenzene (PubChem CID 174871155) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is phenol;1,2,3-trimethoxybenzene.
| Compound Name | phenol;1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 174871155 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | phenol;1,2,3-trimethoxybenzene |
| SMILES | COc1cccc(OC)c1OC.Oc1ccccc1 |
| InChI | InChI=1S/C9H12O3.C6H6O/c1-10-7-5-4-6-8(11-2)9(7)12-3;7-6-4-2-1-3-5-6/h4-6H,1-3H3;1-5,7H |
| InChIKey | PVRUVSSYIOKSTB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |