C26H33N2O6P — CID 146385789
2-bis(2,4,6-trimethoxyphenyl)phosphanyl-1-N,3-N-dimethylbenzene-1,3-diamine (PubChem CID 146385789) has the molecular formula C26H33N2O6P and a molecular weight of 500.53 g/mol. Its IUPAC name is 2-bis(2,4,6-trimethoxyphenyl)phosphanyl-1-N,3-N-dimethylbenzene-1,3-diamine.
| Compound Name | 2-bis(2,4,6-trimethoxyphenyl)phosphanyl-1-N,3-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 146385789 |
| Molecular Formula | C26H33N2O6P |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-bis(2,4,6-trimethoxyphenyl)phosphanyl-1-N,3-N-dimethylbenzene-1,3-diamine |
| SMILES | CNc1cccc(NC)c1P(c1c(OC)cc(OC)cc1OC)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C26H33N2O6P/c1-27-18-10-9-11-19(28-2)24(18)35(25-20(31-5)12-16(29-3)13-21(25)32-6)26-22(33-7)14-17(30-4)15-23(26)34-8/h9-15,27-28H,1-8H3 |
| InChIKey | LXGOTSLMOJFMGS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|