About 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine
4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine (PubChem CID 123748583) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine.
Molecular Properties
| Compound Name | 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine |
| PubChem CID | 123748583 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine |
| SMILES | CNc1cccc2c(OC)ccc(NC)c12 |
| InChI | InChI=1S/C13H16N2O/c1-14-10-6-4-5-9-12(16-3)8-7-11(15-2)13(9)10/h4-8,14-15H,1-3H3 |
| InChIKey | WFUBVJSPGQKDRB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine?
The IUPAC name of 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine (CID 123748583) is 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine.
What is the SMILES notation for 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine?
The canonical SMILES for 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine is CNc1cccc2c(OC)ccc(NC)c12.
What is the InChIKey of 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine?
The InChIKey is WFUBVJSPGQKDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-14-10-6-4-5-9-12(16-3)8-7-11(15-2)13(9)10/h4-8,14-15H,1-3H3.
What are the key properties of 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine?
4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine has a molecular weight of 216.28 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine is sourced from PubChem (CID 123748583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).