C13H16N2O — CID 123748583
4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine (PubChem CID 123748583) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine.
| Compound Name | 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 123748583 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-methoxy-1-N,8-N-dimethylnaphthalene-1,8-diamine |
| SMILES | CNc1cccc2c(OC)ccc(NC)c12 |
| InChI | InChI=1S/C13H16N2O/c1-14-10-6-4-5-9-12(16-3)8-7-11(15-2)13(9)10/h4-8,14-15H,1-3H3 |
| InChIKey | WFUBVJSPGQKDRB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|