C23H18O3 — CID 72722587
7,15,17-trimethoxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3(8),4,6,9,12(20),13,15,17-decaene (PubChem CID 72722587) has the molecular formula C23H18O3 and a molecular weight of 342.39 g/mol. Its IUPAC name is 7,15,17-trimethoxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3(8),4,6,9,12(20),13,15,17-decaene.
| Compound Name | 7,15,17-trimethoxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3(8),4,6,9,12(20),13,15,17-decaene |
|---|---|
| PubChem CID | 72722587 |
| Molecular Formula | C23H18O3 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 7,15,17-trimethoxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3(8),4,6,9,12(20),13,15,17-decaene |
| SMILES | COc1cccc2c3c(ccc12)-c1ccc(OC)c2c(OC)ccc-3c12 |
| InChI | InChI=1S/C23H18O3/c1-24-18-6-4-5-14-13(18)7-8-15-16-9-11-19(25-2)23-20(26-3)12-10-17(21(14)15)22(16)23/h4-12H,1-3H3 |
| InChIKey | AIYZIEMPRDXSBT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |