C11H19NO2 — CID 143206191
2,4-dimethoxy-N-methylaniline;ethane (PubChem CID 143206191) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2,4-dimethoxy-N-methylaniline;ethane.
| Compound Name | 2,4-dimethoxy-N-methylaniline;ethane |
|---|---|
| PubChem CID | 143206191 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2,4-dimethoxy-N-methylaniline;ethane |
| SMILES | CC.CNc1ccc(OC)cc1OC |
| InChI | InChI=1S/C9H13NO2.C2H6/c1-10-8-5-4-7(11-2)6-9(8)12-3;1-2/h4-6,10H,1-3H3;1-2H3 |
| InChIKey | VDFPTYFCTHMDNG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|