C25H29O4P — CID 58418968
2-tert-butyl-6-[phenyl-(2,4,6-trimethoxyphenyl)phosphanyl]phenol (PubChem CID 58418968) has the molecular formula C25H29O4P and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-tert-butyl-6-[phenyl-(2,4,6-trimethoxyphenyl)phosphanyl]phenol.
| Compound Name | 2-tert-butyl-6-[phenyl-(2,4,6-trimethoxyphenyl)phosphanyl]phenol |
|---|---|
| PubChem CID | 58418968 |
| Molecular Formula | C25H29O4P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-tert-butyl-6-[phenyl-(2,4,6-trimethoxyphenyl)phosphanyl]phenol |
| SMILES | COc1cc(OC)c(P(c2ccccc2)c2cccc(C(C)(C)C)c2O)c(OC)c1 |
| InChI | InChI=1S/C25H29O4P/c1-25(2,3)19-13-10-14-22(23(19)26)30(18-11-8-7-9-12-18)24-20(28-5)15-17(27-4)16-21(24)29-6/h7-16,26H,1-6H3 |
| InChIKey | GRZWKGUGFJWLGU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|