C26H32NO2P — CID 58418959
2-tert-butyl-6-[[2-(dimethylamino)phenyl]-(2-methoxy-6-methylphenyl)phosphanyl]phenol (PubChem CID 58418959) has the molecular formula C26H32NO2P and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-(dimethylamino)phenyl]-(2-methoxy-6-methylphenyl)phosphanyl]phenol.
| Compound Name | 2-tert-butyl-6-[[2-(dimethylamino)phenyl]-(2-methoxy-6-methylphenyl)phosphanyl]phenol |
|---|---|
| PubChem CID | 58418959 |
| Molecular Formula | C26H32NO2P |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-tert-butyl-6-[[2-(dimethylamino)phenyl]-(2-methoxy-6-methylphenyl)phosphanyl]phenol |
| SMILES | COc1cccc(C)c1P(c1ccccc1N(C)C)c1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H32NO2P/c1-18-12-10-15-21(29-7)25(18)30(22-16-9-8-14-20(22)27(5)6)23-17-11-13-19(24(23)28)26(2,3)4/h8-17,28H,1-7H3 |
| InChIKey | DGJHENURWQVSMC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|