C24H27O3P — CID 58660014
2-bis(2-methoxyphenyl)phosphanyl-6-tert-butylphenol (PubChem CID 58660014) has the molecular formula C24H27O3P and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-bis(2-methoxyphenyl)phosphanyl-6-tert-butylphenol.
| Compound Name | 2-bis(2-methoxyphenyl)phosphanyl-6-tert-butylphenol |
|---|---|
| PubChem CID | 58660014 |
| Molecular Formula | C24H27O3P |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-bis(2-methoxyphenyl)phosphanyl-6-tert-butylphenol |
| SMILES | COc1ccccc1P(c1ccccc1OC)c1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H27O3P/c1-24(2,3)17-11-10-16-22(23(17)25)28(20-14-8-6-12-18(20)26-4)21-15-9-7-13-19(21)27-5/h6-16,25H,1-5H3 |
| InChIKey | QWWNHWHZKHJMOA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|