C25H33O3P — CID 154718116
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(2-methoxyphenyl)-phenylphosphanyl]acetate (PubChem CID 154718116) has the molecular formula C25H33O3P and a molecular weight of 412.51 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(2-methoxyphenyl)-phenylphosphanyl]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(2-methoxyphenyl)-phenylphosphanyl]acetate |
|---|---|
| PubChem CID | 154718116 |
| Molecular Formula | C25H33O3P |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(2-methoxyphenyl)-phenylphosphanyl]acetate |
| SMILES | COc1ccccc1P(CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H33O3P/c1-18(2)21-15-14-19(3)16-23(21)28-25(26)17-29(20-10-6-5-7-11-20)24-13-9-8-12-22(24)27-4/h5-13,18-19,21,23H,14-17H2,1-4H3/t19-,21+,23-,29?/m1/s1 |
| InChIKey | GKCYHVLBCVBMJJ-RASNBTFVSA-N |
| XLogP | 5.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|