C16H26 — CID 102208674
1,3-bis[(2S)-2-methylbutyl]benzene (PubChem CID 102208674) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1,3-bis[(2S)-2-methylbutyl]benzene.
| Compound Name | 1,3-bis[(2S)-2-methylbutyl]benzene |
|---|---|
| PubChem CID | 102208674 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1,3-bis[(2S)-2-methylbutyl]benzene |
| SMILES | CC[C@H](C)Cc1cccc(C[C@@H](C)CC)c1 |
| InChI | InChI=1S/C16H26/c1-5-13(3)10-15-8-7-9-16(12-15)11-14(4)6-2/h7-9,12-14H,5-6,10-11H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | WCXXHMGBYJKUFO-KBPBESRZSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |