C13H20O2 — CID 104846103
2-methyl-1-phenylhexane-1,5-diol (PubChem CID 104846103) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-methyl-1-phenylhexane-1,5-diol.
| Compound Name | 2-methyl-1-phenylhexane-1,5-diol |
|---|---|
| PubChem CID | 104846103 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-methyl-1-phenylhexane-1,5-diol |
| SMILES | CC(O)CCC(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C13H20O2/c1-10(8-9-11(2)14)13(15)12-6-4-3-5-7-12/h3-7,10-11,13-15H,8-9H2,1-2H3 |
| InChIKey | DYNFUCUMWKBJAW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |