C10H16NO+ — CID 6922967
[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium (PubChem CID 6922967) has the molecular formula C10H16NO+ and a molecular weight of 166.24 g/mol. Its IUPAC name is [(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium.
| Compound Name | [(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 6922967 |
| Molecular Formula | C10H16NO+ |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | [(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium |
| SMILES | C[NH2+][C@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/p+1/t8-,10-/m1/s1 |
| InChIKey | KWGRBVOPPLSCSI-PSASIEDQSA-O |
| XLogP | 0.30 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |