C11H17ClFNO — CID 110174078
2-fluoroethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride (PubChem CID 110174078) has the molecular formula C11H17ClFNO and a molecular weight of 233.71 g/mol. Its IUPAC name is 2-fluoroethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride.
| Compound Name | 2-fluoroethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110174078 |
| Molecular Formula | C11H17ClFNO |
| Molecular Weight | 233.71 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-fluoroethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
| SMILES | CC([NH2+]CCF)C(O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C11H16FNO.ClH/c1-9(13-8-7-12)11(14)10-5-3-2-4-6-10;/h2-6,9,11,13-14H,7-8H2,1H3;1H |
| InChIKey | XALWCLYXIBDILT-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.71 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |