C12H17ClN2O — CID 110178076
2-cyanoethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride (PubChem CID 110178076) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 2-cyanoethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride.
| Compound Name | 2-cyanoethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110178076 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-cyanoethyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
| SMILES | CC([NH2+]CCC#N)C(O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C12H16N2O.ClH/c1-10(14-9-5-8-13)12(15)11-6-3-2-4-7-11;/h2-4,6-7,10,12,14-15H,5,9H2,1H3;1H |
| InChIKey | QWRWZJMBECAHIX-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 60.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|