C20H29N2O+ — CID 7345678
[4-(diethylamino)phenyl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium (PubChem CID 7345678) has the molecular formula C20H29N2O+ and a molecular weight of 313.47 g/mol. Its IUPAC name is [4-(diethylamino)phenyl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium.
| Compound Name | [4-(diethylamino)phenyl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 7345678 |
| Molecular Formula | C20H29N2O+ |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | [4-(diethylamino)phenyl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium |
| SMILES | CCN(CC)c1ccc(C[NH2+][C@H](C)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H28N2O/c1-4-22(5-2)19-13-11-17(12-14-19)15-21-16(3)20(23)18-9-7-6-8-10-18/h6-14,16,20-21,23H,4-5,15H2,1-3H3/p+1/t16-,20-/m1/s1 |
| InChIKey | JJKDTEZQUKMXFX-OXQOHEQNSA-O |
| XLogP | 2.72 |
| TPSA | 40.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|