C12H16NO+ — CID 7331312
[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-prop-2-ynylazanium (PubChem CID 7331312) has the molecular formula C12H16NO+ and a molecular weight of 190.27 g/mol. Its IUPAC name is [(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-prop-2-ynylazanium.
| Compound Name | [(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-prop-2-ynylazanium |
|---|---|
| PubChem CID | 7331312 |
| Molecular Formula | C12H16NO+ |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | [(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-prop-2-ynylazanium |
| SMILES | C#CC[NH2+][C@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO/c1-3-9-13-10(2)12(14)11-7-5-4-6-8-11/h1,4-8,10,12-14H,9H2,2H3/p+1/t10-,12-/m1/s1 |
| InChIKey | KMOIUKZBKVNBOP-ZYHUDNBSSA-O |
| XLogP | 0.31 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|