C17H22ClNO2S — CID 110177289
(1-hydroxy-1-phenylpropan-2-yl)-(2-methyl-3-oxo-3-thiophen-2-ylpropyl)azanium chloride (PubChem CID 110177289) has the molecular formula C17H22ClNO2S and a molecular weight of 339.89 g/mol. Its IUPAC name is (1-hydroxy-1-phenylpropan-2-yl)-(2-methyl-3-oxo-3-thiophen-2-ylpropyl)azanium chloride.
| Compound Name | (1-hydroxy-1-phenylpropan-2-yl)-(2-methyl-3-oxo-3-thiophen-2-ylpropyl)azanium chloride |
|---|---|
| PubChem CID | 110177289 |
| Molecular Formula | C17H22ClNO2S |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (1-hydroxy-1-phenylpropan-2-yl)-(2-methyl-3-oxo-3-thiophen-2-ylpropyl)azanium chloride |
| SMILES | CC(C[NH2+]C(C)C(O)c1ccccc1)C(=O)c1cccs1.[Cl-] |
| InChI | InChI=1S/C17H21NO2S.ClH/c1-12(16(19)15-9-6-10-21-15)11-18-13(2)17(20)14-7-4-3-5-8-14;/h3-10,12-13,17-18,20H,11H2,1-2H3;1H |
| InChIKey | AKTNQHBGECWSSA-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |