C20H24ClNO2 — CID 110175418
(1-hydroxy-1-phenylpropan-2-yl)-[(E)-3-oxo-5-phenylpent-4-enyl]azanium chloride (PubChem CID 110175418) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is (1-hydroxy-1-phenylpropan-2-yl)-[(E)-3-oxo-5-phenylpent-4-enyl]azanium chloride.
| Compound Name | (1-hydroxy-1-phenylpropan-2-yl)-[(E)-3-oxo-5-phenylpent-4-enyl]azanium chloride |
|---|---|
| PubChem CID | 110175418 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (1-hydroxy-1-phenylpropan-2-yl)-[(E)-3-oxo-5-phenylpent-4-enyl]azanium chloride |
| SMILES | CC([NH2+]CCC(=O)/C=C/c1ccccc1)C(O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H23NO2.ClH/c1-16(20(23)18-10-6-3-7-11-18)21-15-14-19(22)13-12-17-8-4-2-5-9-17;/h2-13,16,20-21,23H,14-15H2,1H3;1H/b13-12+; |
| InChIKey | LVSGEGYOAGQKIZ-UEIGIMKUSA-N |
| XLogP | -0.65 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|