C19H26ClNO4 — CID 110177366
(1-hydroxy-1-phenylpropan-2-yl)-[3-oxo-3-(4,5,5-trimethyl-2-oxofuran-3-yl)propyl]azanium chloride (PubChem CID 110177366) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is (1-hydroxy-1-phenylpropan-2-yl)-[3-oxo-3-(4,5,5-trimethyl-2-oxofuran-3-yl)propyl]azanium chloride.
| Compound Name | (1-hydroxy-1-phenylpropan-2-yl)-[3-oxo-3-(4,5,5-trimethyl-2-oxofuran-3-yl)propyl]azanium chloride |
|---|---|
| PubChem CID | 110177366 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (1-hydroxy-1-phenylpropan-2-yl)-[3-oxo-3-(4,5,5-trimethyl-2-oxofuran-3-yl)propyl]azanium chloride |
| SMILES | CC1=C(C(=O)CC[NH2+]C(C)C(O)c2ccccc2)C(=O)OC1(C)C.[Cl-] |
| InChI | InChI=1S/C19H25NO4.ClH/c1-12-16(18(23)24-19(12,3)4)15(21)10-11-20-13(2)17(22)14-8-6-5-7-9-14;/h5-9,13,17,20,22H,10-11H2,1-4H3;1H |
| InChIKey | HMVZMGXVDZIZRN-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|