C32H46ClNO3 — CID 110177951
(1-hydroxy-1-phenylpropan-2-yl)-[3-(3-hydroxy-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-oxopropyl]azanium chloride (PubChem CID 110177951) has the molecular formula C32H46ClNO3 and a molecular weight of 528.18 g/mol. Its IUPAC name is (1-hydroxy-1-phenylpropan-2-yl)-[3-(3-hydroxy-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-oxopropyl]azanium chloride.
| Compound Name | (1-hydroxy-1-phenylpropan-2-yl)-[3-(3-hydroxy-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-oxopropyl]azanium chloride |
|---|---|
| PubChem CID | 110177951 |
| Molecular Formula | C32H46ClNO3 |
| Molecular Weight | 528.18 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | (1-hydroxy-1-phenylpropan-2-yl)-[3-(3-hydroxy-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-oxopropyl]azanium chloride |
| SMILES | CC1=C(C(=O)CC[NH2+]C(C)C(O)c2ccccc2)C2(C)CCC3C(CC=C4CC(O)CCC43C)C2C1.[Cl-] |
| InChI | InChI=1S/C32H45NO3.ClH/c1-20-18-27-25-11-10-23-19-24(34)12-15-31(23,3)26(25)13-16-32(27,4)29(20)28(35)14-17-33-21(2)30(36)22-8-6-5-7-9-22;/h5-10,21,24-27,30,33-34,36H,11-19H2,1-4H3;1H |
| InChIKey | KCBXLMDUAYYOJJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|