C21H33NO5 — CID 110186095
(3-cyclohexyl-3-oxopropyl)-(1-hydroxy-1-phenylpropan-2-yl)azanium;2-hydroxypropanoate (PubChem CID 110186095) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is (3-cyclohexyl-3-oxopropyl)-(1-hydroxy-1-phenylpropan-2-yl)azanium;2-hydroxypropanoate.
| Compound Name | (3-cyclohexyl-3-oxopropyl)-(1-hydroxy-1-phenylpropan-2-yl)azanium;2-hydroxypropanoate |
|---|---|
| PubChem CID | 110186095 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (3-cyclohexyl-3-oxopropyl)-(1-hydroxy-1-phenylpropan-2-yl)azanium;2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].CC([NH2+]CCC(=O)C1CCCCC1)C(O)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2.C3H6O3/c1-14(18(21)16-10-6-3-7-11-16)19-13-12-17(20)15-8-4-2-5-9-15;1-2(4)3(5)6/h3,6-7,10-11,14-15,18-19,21H,2,4-5,8-9,12-13H2,1H3;2,4H,1H3,(H,5,6) |
| InChIKey | MYCCNGSLCVBALL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |