C16H24NO+ — CID 7384532
4,4-dimethylpent-2-ynyl-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium (PubChem CID 7384532) has the molecular formula C16H24NO+ and a molecular weight of 246.37 g/mol. Its IUPAC name is 4,4-dimethylpent-2-ynyl-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium.
| Compound Name | 4,4-dimethylpent-2-ynyl-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 7384532 |
| Molecular Formula | C16H24NO+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 4,4-dimethylpent-2-ynyl-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]azanium |
| SMILES | C[C@@H]([NH2+]CC#CC(C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO/c1-13(17-12-8-11-16(2,3)4)15(18)14-9-6-5-7-10-14/h5-7,9-10,13,15,17-18H,12H2,1-4H3/p+1/t13-,15+/m1/s1 |
| InChIKey | QHNZUAXYUSAKJQ-HIFRSBDPSA-O |
| XLogP | 1.72 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|