C12H20ClNO2 — CID 110184055
[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-propylazanium chloride (PubChem CID 110184055) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is [1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-propylazanium chloride.
| Compound Name | [1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-propylazanium chloride |
|---|---|
| PubChem CID | 110184055 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | [1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-propylazanium chloride |
| SMILES | CCC[NH2+]C(C)C(O)c1ccc(O)cc1.[Cl-] |
| InChI | InChI=1S/C12H19NO2.ClH/c1-3-8-13-9(2)12(15)10-4-6-11(14)7-5-10;/h4-7,9,12-15H,3,8H2,1-2H3;1H |
| InChIKey | RAMNFHHZZIPOCJ-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 57.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |