C9H14NO2+ — CID 6931144
[(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]azanium (PubChem CID 6931144) has the molecular formula C9H14NO2+ and a molecular weight of 168.22 g/mol. Its IUPAC name is [(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]azanium.
| Compound Name | [(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]azanium |
|---|---|
| PubChem CID | 6931144 |
| Molecular Formula | C9H14NO2+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | [(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]azanium |
| SMILES | C[C@@H]([NH3+])[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO2/c1-6(10)9(12)7-2-4-8(11)5-3-7/h2-6,9,11-12H,10H2,1H3/p+1/t6-,9+/m1/s1 |
| InChIKey | JAYBQRKXEFDRER-MUWHJKNJSA-O |
| XLogP | 0.06 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |