C22H28N2O6 — CID 110183024
(E)-4-[[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]-4-oxobut-2-enoate;(1-hydroxy-1-phenylpropan-2-yl)azanium (PubChem CID 110183024) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is (E)-4-[[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]-4-oxobut-2-enoate;(1-hydroxy-1-phenylpropan-2-yl)azanium.
| Compound Name | (E)-4-[[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]-4-oxobut-2-enoate;(1-hydroxy-1-phenylpropan-2-yl)azanium |
|---|---|
| PubChem CID | 110183024 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (E)-4-[[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]-4-oxobut-2-enoate;(1-hydroxy-1-phenylpropan-2-yl)azanium |
| SMILES | CC(NC(=O)/C=C/C(=O)[O-])C(O)c1ccc(O)cc1.CC([NH3+])C(O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO5.C9H13NO/c1-8(14-11(16)6-7-12(17)18)13(19)9-2-4-10(15)5-3-9;1-7(10)9(11)8-5-3-2-4-6-8/h2-8,13,15,19H,1H3,(H,14,16)(H,17,18);2-7,9,11H,10H2,1H3/b7-6+; |
| InChIKey | KFICRAKKMJVVBJ-UHDJGPCESA-N |
| XLogP | -0.41 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|