C17H27NO2 — CID 101078871
N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]octanamide (PubChem CID 101078871) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]octanamide.
| Compound Name | N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]octanamide |
|---|---|
| PubChem CID | 101078871 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H27NO2/c1-3-4-5-6-10-13-16(19)18-14(2)17(20)15-11-8-7-9-12-15/h7-9,11-12,14,17,20H,3-6,10,13H2,1-2H3,(H,18,19)/t14-,17-/m0/s1 |
| InChIKey | KDUJQYVMMSBKIZ-YOEHRIQHSA-N |
| XLogP | 3.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|