C18H29NO2 — CID 11543858
(5R)-5-hydroxy-N-[(1S)-1-phenylethyl]decanamide (PubChem CID 11543858) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (5R)-5-hydroxy-N-[(1S)-1-phenylethyl]decanamide.
| Compound Name | (5R)-5-hydroxy-N-[(1S)-1-phenylethyl]decanamide |
|---|---|
| PubChem CID | 11543858 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (5R)-5-hydroxy-N-[(1S)-1-phenylethyl]decanamide |
| SMILES | CCCCC[C@@H](O)CCCC(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO2/c1-3-4-6-12-17(20)13-9-14-18(21)19-15(2)16-10-7-5-8-11-16/h5,7-8,10-11,15,17,20H,3-4,6,9,12-14H2,1-2H3,(H,19,21)/t15-,17+/m0/s1 |
| InChIKey | PEEOVRXPVOXBBJ-DOTOQJQBSA-N |
| XLogP | 3.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|