C12H12NO3- — CID 4157089
4-oxo-4-(1-phenylethylamino)but-2-enoate (PubChem CID 4157089) has the molecular formula C12H12NO3- and a molecular weight of 218.23 g/mol. Its IUPAC name is 4-oxo-4-(1-phenylethylamino)but-2-enoate.
| Compound Name | 4-oxo-4-(1-phenylethylamino)but-2-enoate |
|---|---|
| PubChem CID | 4157089 |
| Molecular Formula | C12H12NO3- |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-oxo-4-(1-phenylethylamino)but-2-enoate |
| SMILES | CC(NC(=O)C=CC(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C12H13NO3/c1-9(10-5-3-2-4-6-10)13-11(14)7-8-12(15)16/h2-9H,1H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | YBCNEBVTRKGSFM-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|