C14H19NO4S — CID 50937000
[(E,2S)-5-oxo-5-[[(1R)-1-phenylethyl]amino]pent-3-en-2-yl] methanesulfonate (PubChem CID 50937000) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is [(E,2S)-5-oxo-5-[[(1R)-1-phenylethyl]amino]pent-3-en-2-yl] methanesulfonate.
| Compound Name | [(E,2S)-5-oxo-5-[[(1R)-1-phenylethyl]amino]pent-3-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 50937000 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [(E,2S)-5-oxo-5-[[(1R)-1-phenylethyl]amino]pent-3-en-2-yl] methanesulfonate |
| SMILES | C[C@@H](/C=C/C(=O)N[C@H](C)c1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C14H19NO4S/c1-11(19-20(3,17)18)9-10-14(16)15-12(2)13-7-5-4-6-8-13/h4-12H,1-3H3,(H,15,16)/b10-9+/t11-,12+/m0/s1 |
| InChIKey | RJCQXEMSOSZVCZ-NYXKHXTOSA-N |
| XLogP | 1.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|