C19H25NO4 — CID 15360336
ethyl (E,3R)-2-acetyl-3-methyl-6-oxo-6-[[(1S)-1-phenylethyl]amino]hex-4-enoate (PubChem CID 15360336) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl (E,3R)-2-acetyl-3-methyl-6-oxo-6-[[(1S)-1-phenylethyl]amino]hex-4-enoate.
| Compound Name | ethyl (E,3R)-2-acetyl-3-methyl-6-oxo-6-[[(1S)-1-phenylethyl]amino]hex-4-enoate |
|---|---|
| PubChem CID | 15360336 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl (E,3R)-2-acetyl-3-methyl-6-oxo-6-[[(1S)-1-phenylethyl]amino]hex-4-enoate |
| SMILES | CCOC(=O)C(C(C)=O)[C@H](C)/C=C/C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-5-24-19(23)18(15(4)21)13(2)11-12-17(22)20-14(3)16-9-7-6-8-10-16/h6-14,18H,5H2,1-4H3,(H,20,22)/b12-11+/t13-,14+,18?/m1/s1 |
| InChIKey | IMCCINBPOVWOKV-NUEOZTHMSA-N |
| XLogP | 2.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|