About [(1S)-1-phenylethyl] methanesulfonate
[(1S)-1-phenylethyl] methanesulfonate (PubChem CID 59868703) has the molecular formula C9H12O3S
and a molecular weight of 200.26 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] methanesulfonate.
Molecular Properties
| Compound Name | [(1S)-1-phenylethyl] methanesulfonate |
| PubChem CID | 59868703 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | [(1S)-1-phenylethyl] methanesulfonate |
| SMILES | C[C@H](OS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C9H12O3S/c1-8(12-13(2,10)11)9-6-4-3-5-7-9/h3-8H,1-2H3/t8-/m0/s1 |
| InChIKey | YEZNCSACSWEGLC-QMMMGPOBSA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-phenylethyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylethyl] methanesulfonate?
The IUPAC name of [(1S)-1-phenylethyl] methanesulfonate (CID 59868703) is [(1S)-1-phenylethyl] methanesulfonate.
What is the SMILES notation for [(1S)-1-phenylethyl] methanesulfonate?
The canonical SMILES for [(1S)-1-phenylethyl] methanesulfonate is C[C@H](OS(C)(=O)=O)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylethyl] methanesulfonate?
The InChIKey is YEZNCSACSWEGLC-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H12O3S/c1-8(12-13(2,10)11)9-6-4-3-5-7-9/h3-8H,1-2H3/t8-/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] methanesulfonate?
[(1S)-1-phenylethyl] methanesulfonate has a molecular weight of 200.26 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] methanesulfonate is sourced from PubChem (CID 59868703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).