C16H18O4S — CID 134282031
(3-hydroxy-1,1-diphenylpropan-2-yl) methanesulfonate (PubChem CID 134282031) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (3-hydroxy-1,1-diphenylpropan-2-yl) methanesulfonate.
| Compound Name | (3-hydroxy-1,1-diphenylpropan-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 134282031 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (3-hydroxy-1,1-diphenylpropan-2-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC(CO)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18O4S/c1-21(18,19)20-15(12-17)16(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15-17H,12H2,1H3 |
| InChIKey | NCLXKPFHLXKRGN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|