C15H15ClO — CID 57151850
2-chloro-3,3-diphenylpropan-1-ol (PubChem CID 57151850) has the molecular formula C15H15ClO and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-chloro-3,3-diphenylpropan-1-ol.
| Compound Name | 2-chloro-3,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 57151850 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-chloro-3,3-diphenylpropan-1-ol |
| SMILES | OCC(Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15ClO/c16-14(11-17)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-15,17H,11H2 |
| InChIKey | XXLSZXDZXOHKRJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|